C25H41NO5S — CID 130368696
4-[[(1S)-1-carboxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropyl]amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 130368696) has the molecular formula C25H41NO5S and a molecular weight of 467.67 g/mol. Its IUPAC name is 4-[[(1S)-1-carboxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropyl]amino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[[(1S)-1-carboxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropyl]amino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130368696 |
| Molecular Formula | C25H41NO5S |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 4-[[(1S)-1-carboxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropyl]amino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC[C@H](NC(=O)C(C)C(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H41NO5S/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-15-32-16-14-22(25(30)31)26-23(27)20(5)21(6)24(28)29/h9,11,13,20-22H,7-8,10,12,14-16H2,1-6H3,(H,26,27)(H,28,29)(H,30,31)/b18-11+,19-13+/t20?,21?,22-/m0/s1 |
| InChIKey | KQGNBWGIWZUWQP-HOBVSXSYSA-N |
| XLogP | 5.46 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|