C25H41N3O5S — CID 46208368
(2R)-2-[(2-acetamido-5-amino-5-oxopentanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 46208368) has the molecular formula C25H41N3O5S and a molecular weight of 495.69 g/mol. Its IUPAC name is (2R)-2-[(2-acetamido-5-amino-5-oxopentanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-acetamido-5-amino-5-oxopentanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 46208368 |
| Molecular Formula | C25H41N3O5S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (2R)-2-[(2-acetamido-5-amino-5-oxopentanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CCC(N)=O)C(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C25H41N3O5S/c1-17(2)8-6-9-18(3)10-7-11-19(4)14-15-34-16-22(25(32)33)28-24(31)21(27-20(5)29)12-13-23(26)30/h8,10,14,21-22H,6-7,9,11-13,15-16H2,1-5H3,(H2,26,30)(H,27,29)(H,28,31)(H,32,33)/b18-10+,19-14+/t21?,22-/m0/s1 |
| InChIKey | STUXRBUZAJMFRQ-LOMUBLIISA-N |
| XLogP | 3.48 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|