C24H39NO3S — CID 90715909
(2R)-2-acetamido-3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 90715909) has the molecular formula C24H39NO3S and a molecular weight of 421.65 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 90715909 |
| Molecular Formula | C24H39NO3S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (2R)-2-acetamido-3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSCC=C(CC=C(C)C)CCC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C24H39NO3S/c1-18(2)9-7-10-20(5)11-8-12-22(14-13-19(3)4)15-16-29-17-23(24(27)28)25-21(6)26/h9,11,13,15,23H,7-8,10,12,14,16-17H2,1-6H3,(H,25,26)(H,27,28)/t23-/m0/s1 |
| InChIKey | VQFNFRQNLQVQIW-QHCPKHFHSA-N |
| XLogP | 6.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|