C28H43NO2S — CID 76691908
3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-[(2-methylcyclopenta-1,3-dien-1-yl)amino]propanoic acid (PubChem CID 76691908) has the molecular formula C28H43NO2S and a molecular weight of 457.72 g/mol. Its IUPAC name is 3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-[(2-methylcyclopenta-1,3-dien-1-yl)amino]propanoic acid.
| Compound Name | 3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-[(2-methylcyclopenta-1,3-dien-1-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 76691908 |
| Molecular Formula | C28H43NO2S |
| Molecular Weight | 457.72 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 3-[7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-[(2-methylcyclopenta-1,3-dien-1-yl)amino]propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(=CCSCC(NC1=C(C)C=CC1)C(=O)O)CC=C(C)C |
| InChI | InChI=1S/C28H43NO2S/c1-21(2)10-7-11-23(5)12-8-14-25(17-16-22(3)4)18-19-32-20-27(28(30)31)29-26-15-9-13-24(26)6/h9-10,12-13,16,18,27,29H,7-8,11,14-15,17,19-20H2,1-6H3,(H,30,31) |
| InChIKey | HJAYGTFRXWPZCG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.72 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|