C24H35NO4S2 — CID 54580569
(2R)-2-(benzenesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 54580569) has the molecular formula C24H35NO4S2 and a molecular weight of 465.68 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(benzenesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54580569 |
| Molecular Formula | C24H35NO4S2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H35NO4S2/c1-19(2)10-8-11-20(3)12-9-13-21(4)16-17-30-18-23(24(26)27)25-31(28,29)22-14-6-5-7-15-22/h5-7,10,12,14-16,23,25H,8-9,11,13,17-18H2,1-4H3,(H,26,27)/b20-12+,21-16+/t23-/m0/s1 |
| InChIKey | ZTPQEXIBYYNKBX-UBXMOETMSA-N |
| XLogP | 5.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|