C27H39NO5S2 — CID 42612760
(2R)-2-[3-(benzenesulfonyl)propanoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 42612760) has the molecular formula C27H39NO5S2 and a molecular weight of 521.75 g/mol. Its IUPAC name is (2R)-2-[3-(benzenesulfonyl)propanoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[3-(benzenesulfonyl)propanoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 42612760 |
| Molecular Formula | C27H39NO5S2 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2R)-2-[3-(benzenesulfonyl)propanoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)CCS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H39NO5S2/c1-21(2)10-8-11-22(3)12-9-13-23(4)16-18-34-20-25(27(30)31)28-26(29)17-19-35(32,33)24-14-6-5-7-15-24/h5-7,10,12,14-16,25H,8-9,11,13,17-20H2,1-4H3,(H,28,29)(H,30,31)/b22-12+,23-16+/t25-/m0/s1 |
| InChIKey | WVDOKXVKNZYEFT-IMVJZRCSSA-N |
| XLogP | 5.57 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|