C44H68CaN2O10S2 — CID 173080485
calcium bis(4-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]amino]-4-oxobutanoate) (PubChem CID 173080485) has the molecular formula C44H68CaN2O10S2 and a molecular weight of 889.24 g/mol. Its IUPAC name is calcium bis(4-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]amino]-4-oxobutanoate).
| Compound Name | calcium bis(4-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]amino]-4-oxobutanoate) |
|---|---|
| PubChem CID | 173080485 |
| Molecular Formula | C44H68CaN2O10S2 |
| Molecular Weight | 889.24 g/mol |
| Exact Mass | 888.39 |
| IUPAC Name | calcium bis(4-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]amino]-4-oxobutanoate) |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NC(=O)CCC(=O)[O-])C(=O)O.CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NC(=O)CCC(=O)[O-])C(=O)O.[Ca+2] |
| InChI | InChI=1S/2C22H35NO5S.Ca/c2*1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-29-15-19(22(27)28)23-20(24)11-12-21(25)26;/h2*7,9,13,19H,5-6,8,10-12,14-15H2,1-4H3,(H,23,24)(H,25,26)(H,27,28);/q;;+2/p-2/t2*19-;/m00./s1 |
| InChIKey | DREIFEFVXLRHQN-UFEREZMFSA-L |
| XLogP | 6.10 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.24 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|