C22H38N2O5S — CID 158934063
methane;(2R)-2-(3-nitropropanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 158934063) has the molecular formula C22H38N2O5S and a molecular weight of 442.62 g/mol. Its IUPAC name is methane;(2R)-2-(3-nitropropanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | methane;(2R)-2-(3-nitropropanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 158934063 |
| Molecular Formula | C22H38N2O5S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | methane;(2R)-2-(3-nitropropanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | C.CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)CC[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C21H34N2O5S.CH4/c1-16(2)7-5-8-17(3)9-6-10-18(4)12-14-29-15-19(21(25)26)22-20(24)11-13-23(27)28;/h7,9,12,19H,5-6,8,10-11,13-15H2,1-4H3,(H,22,24)(H,25,26);1H4/b17-9+,18-12+;/t19-;/m0./s1 |
| InChIKey | JJKVRJFKTDYBSH-ZMDQSOSJSA-N |
| XLogP | 5.01 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|