C22H33NO5S — CID 87295539
4-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 87295539) has the molecular formula C22H33NO5S and a molecular weight of 423.58 g/mol. Its IUPAC name is 4-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 87295539 |
| Molecular Formula | C22H33NO5S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(NC(=O)C=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H33NO5S/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-29-15-19(22(27)28)23-20(24)11-12-21(25)26/h7,9,11-13,19H,5-6,8,10,14-15H2,1-4H3,(H,23,24)(H,25,26)(H,27,28)/b12-11?,17-9+,18-13+ |
| InChIKey | HLIFKUWAEUZMIG-OEEDEWGBSA-N |
| XLogP | 4.35 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|