C24H37NO4S — CID 89072546
4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-methylidenepent-4-enoic acid (PubChem CID 89072546) has the molecular formula C24H37NO4S and a molecular weight of 435.63 g/mol. Its IUPAC name is 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-methylidenepent-4-enoic acid.
| Compound Name | 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-methylidenepent-4-enoic acid |
|---|---|
| PubChem CID | 89072546 |
| Molecular Formula | C24H37NO4S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-methylidenepent-4-enoic acid |
| SMILES | C=C(CC(=C)C(=O)O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C24H37NO4S/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-14-30-16-22(24(28)29)25-21(6)15-20(5)23(26)27/h9,11,13,22,25H,5-8,10,12,14-16H2,1-4H3,(H,26,27)(H,28,29)/b18-11+,19-13+/t22-/m0/s1 |
| InChIKey | AZNDAWNIXHVHKY-FGGSXCAGSA-N |
| XLogP | 5.73 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|