C25H42N2O3S — CID 134568544
2-[2-(methylamino)hex-5-enoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 134568544) has the molecular formula C25H42N2O3S and a molecular weight of 450.69 g/mol. Its IUPAC name is 2-[2-(methylamino)hex-5-enoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-(methylamino)hex-5-enoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134568544 |
| Molecular Formula | C25H42N2O3S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 2-[2-(methylamino)hex-5-enoylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | C=CCCC(NC)C(=O)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C25H42N2O3S/c1-7-8-15-22(26-6)24(28)27-23(25(29)30)18-31-17-16-21(5)14-10-13-20(4)12-9-11-19(2)3/h7,11,13,16,22-23,26H,1,8-10,12,14-15,17-18H2,2-6H3,(H,27,28)(H,29,30)/b20-13+,21-16+ |
| InChIKey | JUQZCYDYFDBCPV-QUIOSVDYSA-N |
| XLogP | 5.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|