C27H48N2O6S — CID 159151187
(2R)-2-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;methane (PubChem CID 159151187) has the molecular formula C27H48N2O6S and a molecular weight of 528.76 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;methane.
| Compound Name | (2R)-2-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;methane |
|---|---|
| PubChem CID | 159151187 |
| Molecular Formula | C27H48N2O6S |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (2R)-2-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;methane |
| SMILES | C.CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)[C@H](CO)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H44N2O6S.CH4/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-35-17-22(24(31)32)27-23(30)21(16-29)28-25(33)34-26(5,6)7;/h10,12,14,21-22,29H,8-9,11,13,15-17H2,1-7H3,(H,27,30)(H,28,33)(H,31,32);1H4/b19-12+,20-14+;/t21-,22-;/m0./s1 |
| InChIKey | KJHSRKWQQDOFHN-URHCCNHZSA-N |
| XLogP | 5.23 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|