C23H41NO3S — CID 18664342
tert-butyl N-[(2R)-1-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]carbamate (PubChem CID 18664342) has the molecular formula C23H41NO3S and a molecular weight of 411.65 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18664342 |
| Molecular Formula | C23H41NO3S |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | tert-butyl N-[(2R)-1-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]carbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41NO3S/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-28-17-21(16-25)24-22(26)27-23(5,6)7/h10,12,14,21,25H,8-9,11,13,15-17H2,1-7H3,(H,24,26)/b19-12+,20-14+/t21-/m1/s1 |
| InChIKey | IARPMAWCGQFSNH-AOMOKSILSA-N |
| XLogP | 6.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|