C21H35NO3S — CID 54096848
methyl (2R)-2-acetamido-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoate (PubChem CID 54096848) has the molecular formula C21H35NO3S and a molecular weight of 381.58 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoate |
|---|---|
| PubChem CID | 54096848 |
| Molecular Formula | C21H35NO3S |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | methyl (2R)-2-acetamido-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoate |
| SMILES | COC(=O)[C@H](CSCC=C(C)CCC=C(C)CCC=C(C)C)NC(C)=O |
| InChI | InChI=1S/C21H35NO3S/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-26-15-20(21(24)25-6)22-19(5)23/h9,11,13,20H,7-8,10,12,14-15H2,1-6H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | MXSBUVKSWFWHTQ-FQEVSTJZSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|