C26H46N4O3S — CID 87525692
(2R,3S)-2-acetamido-N-[(2R)-1-hydrazinyl-1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylpentanamide (PubChem CID 87525692) has the molecular formula C26H46N4O3S and a molecular weight of 494.75 g/mol. Its IUPAC name is (2R,3S)-2-acetamido-N-[(2R)-1-hydrazinyl-1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylpentanamide.
| Compound Name | (2R,3S)-2-acetamido-N-[(2R)-1-hydrazinyl-1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 87525692 |
| Molecular Formula | C26H46N4O3S |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | (2R,3S)-2-acetamido-N-[(2R)-1-hydrazinyl-1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@@H](NC(C)=O)C(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)NN |
| InChI | InChI=1S/C26H46N4O3S/c1-8-21(6)24(28-22(7)31)26(33)29-23(25(32)30-27)17-34-16-15-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,15,21,23-24H,8-10,12,14,16-17,27H2,1-7H3,(H,28,31)(H,29,33)(H,30,32)/b19-13+,20-15+/t21-,23-,24+/m0/s1 |
| InChIKey | PQRUHMNGCZILQM-FYSVOROFSA-N |
| XLogP | 4.16 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|