C22H38N4O3S — CID 75148727
N'-[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]butanediamide (PubChem CID 75148727) has the molecular formula C22H38N4O3S and a molecular weight of 438.64 g/mol. Its IUPAC name is N'-[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]butanediamide.
| Compound Name | N'-[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]butanediamide |
|---|---|
| PubChem CID | 75148727 |
| Molecular Formula | C22H38N4O3S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N'-[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]butanediamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCC(NC(=O)CCC(N)=O)C(=O)NN |
| InChI | InChI=1S/C22H38N4O3S/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-30-15-19(22(29)26-24)25-21(28)12-11-20(23)27/h7,9,13,19H,5-6,8,10-12,14-15,24H2,1-4H3,(H2,23,27)(H,25,28)(H,26,29) |
| InChIKey | JRPIHXTVMIUQRW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|