C23H39N3O4S — CID 87525905
(3R)-4-[[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]amino]-3-methyl-4-oxobutanoic acid (PubChem CID 87525905) has the molecular formula C23H39N3O4S and a molecular weight of 453.65 g/mol. Its IUPAC name is (3R)-4-[[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]amino]-3-methyl-4-oxobutanoic acid.
| Compound Name | (3R)-4-[[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]amino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87525905 |
| Molecular Formula | C23H39N3O4S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (3R)-4-[[1-hydrazinyl-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]amino]-3-methyl-4-oxobutanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCC(NC(=O)[C@H](C)CC(=O)O)C(=O)NN |
| InChI | InChI=1S/C23H39N3O4S/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-31-15-20(23(30)26-24)25-22(29)19(5)14-21(27)28/h8,10,12,19-20H,6-7,9,11,13-15,24H2,1-5H3,(H,25,29)(H,26,30)(H,27,28)/t19-,20?/m1/s1 |
| InChIKey | GIBJYYZMVSWYDQ-FIWHBWSRSA-N |
| XLogP | 3.72 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|