C24H40N2O4S — CID 158777238
4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-3-methyl-4-oxobutanoic acid (PubChem CID 158777238) has the molecular formula C24H40N2O4S and a molecular weight of 452.66 g/mol. Its IUPAC name is 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-3-methyl-4-oxobutanoic acid.
| Compound Name | 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158777238 |
| Molecular Formula | C24H40N2O4S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 4-[[(2R)-4-amino-3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]amino]-3-methyl-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)C(C)CC(=O)O)C(=O)CN |
| InChI | InChI=1S/C24H40N2O4S/c1-17(2)8-6-9-18(3)10-7-11-19(4)12-13-31-16-21(22(27)15-25)26-24(30)20(5)14-23(28)29/h8,10,12,20-21H,6-7,9,11,13-16,25H2,1-5H3,(H,26,30)(H,28,29)/b18-10+,19-12+/t20?,21-/m0/s1 |
| InChIKey | IQPRPTVUZYUSCI-SJJIXCAXSA-N |
| XLogP | 4.26 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|