C23H38N2O5S — CID 87295335
2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 87295335) has the molecular formula C23H38N2O5S and a molecular weight of 454.63 g/mol. Its IUPAC name is 2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87295335 |
| Molecular Formula | C23H38N2O5S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CO)C(=O)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C23H38N2O5S/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-31-15-21(23(29)30)25-22(28)20(14-26)24-19(5)27/h8,10,12,20-21,26H,6-7,9,11,13-15H2,1-5H3,(H,24,27)(H,25,28)(H,29,30)/b17-10+,18-12+ |
| InChIKey | GUYDKQFFNRDQQG-VZRGJMDUSA-N |
| XLogP | 3.21 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|