C26H44N2O4S — CID 173050794
2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 173050794) has the molecular formula C26H44N2O4S and a molecular weight of 480.72 g/mol. Its IUPAC name is 2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | 2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 173050794 |
| Molecular Formula | C26H44N2O4S |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)NC(CSCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C26H44N2O4S/c1-8-21(6)24(27-22(7)29)25(30)28-23(26(31)32)17-33-16-15-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,15,21,23-24H,8-10,12,14,16-17H2,1-7H3,(H,27,29)(H,28,30)(H,31,32)/t21-,23?,24-/m0/s1 |
| InChIKey | RIROITDGBKARPP-LMOFDZDWSA-N |
| XLogP | 5.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|