C26H46N2O3S — CID 87301259
(2R)-2-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 87301259) has the molecular formula C26H46N2O3S and a molecular weight of 466.73 g/mol. Its IUPAC name is (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87301259 |
| Molecular Formula | C26H46N2O3S |
| Molecular Weight | 466.73 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC[C@H](C)[C@@H](CN[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O)NC(C)=O |
| InChI | InChI=1S/C26H46N2O3S/c1-8-22(6)24(28-23(7)29)17-27-25(26(30)31)18-32-16-15-21(5)14-10-13-20(4)12-9-11-19(2)3/h11,13,15,22,24-25,27H,8-10,12,14,16-18H2,1-7H3,(H,28,29)(H,30,31)/b20-13+,21-15+/t22-,24+,25-/m0/s1 |
| InChIKey | OCKVWNARUCWDLX-YOTHLCHISA-N |
| XLogP | 5.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.73 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|