C22H36N2O4S — CID 89051089
(2R)-2-[(2-acetamidoacetyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 89051089) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is (2R)-2-[(2-acetamidoacetyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-acetamidoacetyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 89051089 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (2R)-2-[(2-acetamidoacetyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NCC(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C22H36N2O4S/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-29-15-20(22(27)28)24-21(26)14-23-19(5)25/h8,10,12,20H,6-7,9,11,13-15H2,1-5H3,(H,23,25)(H,24,26)(H,27,28)/b17-10+,18-12+/t20-/m0/s1 |
| InChIKey | YOXOBTHWSBUGIU-QHHPALHRSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|