C25H41N3O6S — CID 87525455
(2R)-4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(ethylcarbamoylamino)-4-oxobutanoic acid (PubChem CID 87525455) has the molecular formula C25H41N3O6S and a molecular weight of 511.69 g/mol. Its IUPAC name is (2R)-4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(ethylcarbamoylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(ethylcarbamoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87525455 |
| Molecular Formula | C25H41N3O6S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (2R)-4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(ethylcarbamoylamino)-4-oxobutanoic acid |
| SMILES | CCNC(=O)N[C@H](CC(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H41N3O6S/c1-6-26-25(34)28-20(23(30)31)15-22(29)27-21(24(32)33)16-35-14-13-19(5)12-8-11-18(4)10-7-9-17(2)3/h9,11,13,20-21H,6-8,10,12,14-16H2,1-5H3,(H,27,29)(H,30,31)(H,32,33)(H2,26,28,34)/b18-11+,19-13+/t20-,21+/m1/s1 |
| InChIKey | BGTFXEZQJLIKGM-DURCNQANSA-N |
| XLogP | 3.87 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|