C20H31NO4S — CID 134568509
2-(oxaldehydoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 134568509) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-(oxaldehydoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-(oxaldehydoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134568509 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-(oxaldehydoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(NC(=O)C=O)C(=O)O |
| InChI | InChI=1S/C20H31NO4S/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-26-14-18(20(24)25)21-19(23)13-22/h7,9,11,13,18H,5-6,8,10,12,14H2,1-4H3,(H,21,23)(H,24,25)/b16-9+,17-11+ |
| InChIKey | GHRJBZWDIWRMFO-BTMZFSHUSA-N |
| XLogP | 3.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|