C23H35NO5S — CID 46209174
(2R)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 46209174) has the molecular formula C23H35NO5S and a molecular weight of 437.60 g/mol. Its IUPAC name is (2R)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 46209174 |
| Molecular Formula | C23H35NO5S |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2R)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | COC(=O)/C=C/C(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C23H35NO5S/c1-17(2)8-6-9-18(3)10-7-11-19(4)14-15-30-16-20(23(27)28)24-21(25)12-13-22(26)29-5/h8,10,12-14,20H,6-7,9,11,15-16H2,1-5H3,(H,24,25)(H,27,28)/b13-12+,18-10+,19-14+/t20-/m0/s1 |
| InChIKey | ARTPAGBWRYMNMO-LXCLZJFESA-N |
| XLogP | 4.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|