C23H37NO4S — CID 88943883
4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]pent-4-enoic acid (PubChem CID 88943883) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]pent-4-enoic acid.
| Compound Name | 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 88943883 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C23H37NO4S/c1-17(2)8-6-9-18(3)10-7-11-19(4)14-15-29-16-21(23(27)28)24-20(5)12-13-22(25)26/h8,10,14,21,24H,5-7,9,11-13,15-16H2,1-4H3,(H,25,26)(H,27,28)/b18-10+,19-14+/t21-/m0/s1 |
| InChIKey | CTDPXOPQGBTBNG-QFBKQBAQSA-N |
| XLogP | 5.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|