C22H36N2O4S2 — CID 90754886
(2R)-2-(2-carboxyethylcarbamothioylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 90754886) has the molecular formula C22H36N2O4S2 and a molecular weight of 456.67 g/mol. Its IUPAC name is (2R)-2-(2-carboxyethylcarbamothioylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-(2-carboxyethylcarbamothioylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 90754886 |
| Molecular Formula | C22H36N2O4S2 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (2R)-2-(2-carboxyethylcarbamothioylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NC(=S)NCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H36N2O4S2/c1-16(2)7-5-8-17(3)9-6-10-18(4)12-14-30-15-19(21(27)28)24-22(29)23-13-11-20(25)26/h7,9,12,19H,5-6,8,10-11,13-15H2,1-4H3,(H,25,26)(H,27,28)(H2,23,24,29)/t19-/m0/s1 |
| InChIKey | GHQFBGLGVGADNC-IBGZPJMESA-N |
| XLogP | 4.53 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|