C26H44N2O3S — CID 89072529
(2R)-2-[1-(3-ethoxybut-3-enylamino)ethenylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 89072529) has the molecular formula C26H44N2O3S and a molecular weight of 464.72 g/mol. Its IUPAC name is (2R)-2-[1-(3-ethoxybut-3-enylamino)ethenylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[1-(3-ethoxybut-3-enylamino)ethenylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 89072529 |
| Molecular Formula | C26H44N2O3S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (2R)-2-[1-(3-ethoxybut-3-enylamino)ethenylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | C=C(NCCC(=C)OCC)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C26H44N2O3S/c1-8-31-23(6)15-17-27-24(7)28-25(26(29)30)19-32-18-16-22(5)14-10-13-21(4)12-9-11-20(2)3/h11,13,16,25,27-28H,6-10,12,14-15,17-19H2,1-5H3,(H,29,30)/b21-13+,22-16+/t25-/m0/s1 |
| InChIKey | CKXFGKDSGLLSLW-JLAXYXCGSA-N |
| XLogP | 6.18 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|