C24H41NO3S — CID 146358950
(2R)-2-(hexanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 146358950) has the molecular formula C24H41NO3S and a molecular weight of 423.66 g/mol. Its IUPAC name is (2R)-2-(hexanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(hexanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 146358950 |
| Molecular Formula | C24H41NO3S |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (2R)-2-(hexanoylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C24H41NO3S/c1-6-7-8-15-23(26)25-22(24(27)28)18-29-17-16-21(5)14-10-13-20(4)12-9-11-19(2)3/h11,13,16,22H,6-10,12,14-15,17-18H2,1-5H3,(H,25,26)(H,27,28)/b20-13+,21-16+/t22-/m0/s1 |
| InChIKey | COMUHTNEIKQRPO-WQVLZYIFSA-N |
| XLogP | 6.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|