C26H47NO4S2 — CID 54582549
(2R)-2-(octylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 54582549) has the molecular formula C26H47NO4S2 and a molecular weight of 501.80 g/mol. Its IUPAC name is (2R)-2-(octylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(octylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54582549 |
| Molecular Formula | C26H47NO4S2 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | (2R)-2-(octylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CCCCCCCCS(=O)(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C26H47NO4S2/c1-6-7-8-9-10-11-20-33(30,31)27-25(26(28)29)21-32-19-18-24(5)17-13-16-23(4)15-12-14-22(2)3/h14,16,18,25,27H,6-13,15,17,19-21H2,1-5H3,(H,28,29)/b23-16+,24-18+/t25-/m0/s1 |
| InChIKey | RBXCMRWTCWTTRE-BAZISGOMSA-N |
| XLogP | 6.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|