C26H37NO4S2 — CID 54582548
(2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 54582548) has the molecular formula C26H37NO4S2 and a molecular weight of 491.72 g/mol. Its IUPAC name is (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54582548 |
| Molecular Formula | C26H37NO4S2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (2R)-2-[(4-ethenylphenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C26H37NO4S2/c1-6-23-13-15-24(16-14-23)33(30,31)27-25(26(28)29)19-32-18-17-22(5)12-8-11-21(4)10-7-9-20(2)3/h6,9,11,13-17,25,27H,1,7-8,10,12,18-19H2,2-5H3,(H,28,29)/b21-11+,22-17+/t25-/m0/s1 |
| InChIKey | YUOCUMWEARXDJA-QKYKRCRLSA-N |
| XLogP | 6.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|