C24H33ClFNO4S2 — CID 54581748
(2R)-2-[(4-chloro-2-fluorophenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 54581748) has the molecular formula C24H33ClFNO4S2 and a molecular weight of 518.12 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-2-fluorophenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(4-chloro-2-fluorophenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54581748 |
| Molecular Formula | C24H33ClFNO4S2 |
| Molecular Weight | 518.12 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (2R)-2-[(4-chloro-2-fluorophenyl)sulfonylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NS(=O)(=O)c1ccc(Cl)cc1F)C(=O)O |
| InChI | InChI=1S/C24H33ClFNO4S2/c1-17(2)7-5-8-18(3)9-6-10-19(4)13-14-32-16-22(24(28)29)27-33(30,31)23-12-11-20(25)15-21(23)26/h7,9,11-13,15,22,27H,5-6,8,10,14,16H2,1-4H3,(H,28,29)/b18-9+,19-13+/t22-/m0/s1 |
| InChIKey | XQZQYDQNAHFFJL-CCQZMSTDSA-N |
| XLogP | 6.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.12 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|