C21H35NO4S2 — CID 68636770
(2R)-2-(cyclopropylsulfonylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 68636770) has the molecular formula C21H35NO4S2 and a molecular weight of 429.65 g/mol. Its IUPAC name is (2R)-2-(cyclopropylsulfonylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-(cyclopropylsulfonylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 68636770 |
| Molecular Formula | C21H35NO4S2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (2R)-2-(cyclopropylsulfonylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NS(=O)(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C21H35NO4S2/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-27-15-20(21(23)24)22-28(25,26)19-11-12-19/h7,9,13,19-20,22H,5-6,8,10-12,14-15H2,1-4H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | WFJHHMVBZOMRCN-FQEVSTJZSA-N |
| XLogP | 4.67 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|