C20H33NO6S2 — CID 46207834
(2R)-2-(carboxymethylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 46207834) has the molecular formula C20H33NO6S2 and a molecular weight of 447.62 g/mol. Its IUPAC name is (2R)-2-(carboxymethylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(carboxymethylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 46207834 |
| Molecular Formula | C20H33NO6S2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (2R)-2-(carboxymethylsulfonylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NS(=O)(=O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H33NO6S2/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-28-13-18(20(24)25)21-29(26,27)14-19(22)23/h7,9,11,18,21H,5-6,8,10,12-14H2,1-4H3,(H,22,23)(H,24,25)/b16-9+,17-11+/t18-/m0/s1 |
| InChIKey | AVNZNERTDGKZAP-RNKQFFRGSA-N |
| XLogP | 3.60 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|