C22H35NO5S — CID 153323969
2-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobutanoic acid (PubChem CID 153323969) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is 2-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobutanoic acid.
| Compound Name | 2-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 153323969 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[[(1R)-1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(CC=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H35NO5S/c1-16(2)7-5-8-17(3)9-6-10-18(4)12-14-29-15-20(22(27)28)23-19(11-13-24)21(25)26/h7,9,12-13,19-20,23H,5-6,8,10-11,14-15H2,1-4H3,(H,25,26)(H,27,28)/b17-9+,18-12+/t19?,20-/m0/s1 |
| InChIKey | PTYUUYOLMKVEKK-VPCKFSERSA-N |
| XLogP | 4.22 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|