C26H41NO5S — CID 91327569
2-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 91327569) has the molecular formula C26H41NO5S and a molecular weight of 479.68 g/mol. Its IUPAC name is 2-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91327569 |
| Molecular Formula | C26H41NO5S |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-[[(1R)-1-carboxy-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NC(=O)C1CCCCC1C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41NO5S/c1-18(2)9-7-10-19(3)11-8-12-20(4)15-16-33-17-23(26(31)32)27-24(28)21-13-5-6-14-22(21)25(29)30/h9,11,15,21-23H,5-8,10,12-14,16-17H2,1-4H3,(H,27,28)(H,29,30)(H,31,32)/t21?,22?,23-/m0/s1 |
| InChIKey | QZVHKJUGGOTMDT-VNXZQDSDSA-N |
| XLogP | 5.60 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|