C28H45NO2S — CID 69435866
(2R)-2-(1-adamantylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 69435866) has the molecular formula C28H45NO2S and a molecular weight of 459.74 g/mol. Its IUPAC name is (2R)-2-(1-adamantylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(1-adamantylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 69435866 |
| Molecular Formula | C28H45NO2S |
| Molecular Weight | 459.74 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | (2R)-2-(1-adamantylamino)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC12CC3CC(CC(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C28H45NO2S/c1-20(2)7-5-8-21(3)9-6-10-22(4)11-12-32-19-26(27(30)31)29-28-16-23-13-24(17-28)15-25(14-23)18-28/h7,9,11,23-26,29H,5-6,8,10,12-19H2,1-4H3,(H,30,31)/b21-9+,22-11+/t23?,24?,25?,26-,28?/m0/s1 |
| InChIKey | RJTGBLNPVJNVBD-AJDBYPDSSA-N |
| XLogP | 7.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|