C32H50O — CID 71735596
(4E,8E,12E)-1-(1-adamantyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraen-1-one (PubChem CID 71735596) has the molecular formula C32H50O and a molecular weight of 450.75 g/mol. Its IUPAC name is (4E,8E,12E)-1-(1-adamantyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraen-1-one.
| Compound Name | (4E,8E,12E)-1-(1-adamantyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraen-1-one |
|---|---|
| PubChem CID | 71735596 |
| Molecular Formula | C32H50O |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | (4E,8E,12E)-1-(1-adamantyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H50O/c1-24(2)10-6-11-25(3)12-7-13-26(4)14-8-15-27(5)16-9-17-31(33)32-21-28-18-29(22-32)20-30(19-28)23-32/h10,12,14,16,28-30H,6-9,11,13,15,17-23H2,1-5H3/b25-12+,26-14+,27-16+ |
| InChIKey | ZIZCCJWPIQRNHR-WYDSFTNRSA-N |
| XLogP | 9.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|