(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid

C18H30O2 — CID 11076782

IUPAC(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid
SMILESCC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(=O)O
InChIInChI=1S/C18H30O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,19,20)/b16-10+,17-13+
InChIKeyPEFRSINZRLUBKR-QKXOVSGLSA-N
MW278.44 g/mol
LogP5.66
Rot. Bonds10

About (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid

(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid (PubChem CID 11076782) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid.

Molecular Properties

Compound Name(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid
PubChem CID11076782
Molecular FormulaC18H30O2
Molecular Weight278.44 g/mol
Exact Mass278.22
IUPAC Name(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid
SMILESCC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(=O)O
InChIInChI=1S/C18H30O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,19,20)/b16-10+,17-13+
InChIKeyPEFRSINZRLUBKR-QKXOVSGLSA-N
XLogP5.66
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds10
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500278.44
LogP ≤ 55.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid?
The IUPAC name of (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid (CID 11076782) is (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid.
What is the SMILES notation for (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid?
The canonical SMILES for (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid is CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(=O)O.
What is the InChIKey of (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid?
The InChIKey is PEFRSINZRLUBKR-QKXOVSGLSA-N. The full InChI is InChI=1S/C18H30O2/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-18(19)20/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,19,20)/b16-10+,17-13+.
What are the key properties of (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid?
(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid has a molecular weight of 278.44 g/mol, XLogP of 5.66, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienoic acid is sourced from PubChem (CID 11076782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).