C27H44O2 — CID 102141695
(4E,8E,12E,16E)-5,9,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoic acid (PubChem CID 102141695) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (4E,8E,12E,16E)-5,9,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoic acid.
| Compound Name | (4E,8E,12E,16E)-5,9,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoic acid |
|---|---|
| PubChem CID | 102141695 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (4E,8E,12E,16E)-5,9,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(=O)O |
| InChI | InChI=1S/C27H44O2/c1-22(2)12-7-13-23(3)14-8-15-24(4)16-9-17-25(5)18-10-19-26(6)20-11-21-27(28)29/h12,14,16,18,20H,7-11,13,15,17,19,21H2,1-6H3,(H,28,29)/b23-14+,24-16+,25-18+,26-20+ |
| InChIKey | OWFUVJFTLRLZTD-BONKTHMWSA-N |
| XLogP | 8.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|