C90H150 — CID 173324782
2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 173324782) has the molecular formula C90H150 and a molecular weight of 1232.19 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 173324782 |
| Molecular Formula | C90H150 |
| Molecular Weight | 1232.19 g/mol |
| Exact Mass | 1231.17 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C.CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C.CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/3C30H50/c3*1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h3*15-18,23-24H,9-14,19-22H2,1-8H3 |
| InChIKey | OMAIHYNXONJRML-UHFFFAOYSA-N |
| XLogP | 31.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 45 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1232.19 |
| LogP ≤ 5 | 31.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|