C26H44 — CID 91751137
(6E,10E,14E,18E)-2,6,11,15,19-pentamethylhenicosa-2,6,10,14,18-pentaene (PubChem CID 91751137) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is (6E,10E,14E,18E)-2,6,11,15,19-pentamethylhenicosa-2,6,10,14,18-pentaene.
| Compound Name | (6E,10E,14E,18E)-2,6,11,15,19-pentamethylhenicosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 91751137 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | (6E,10E,14E,18E)-2,6,11,15,19-pentamethylhenicosa-2,6,10,14,18-pentaene |
| SMILES | CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H44/c1-8-23(4)17-12-19-26(7)21-13-20-25(6)16-10-9-15-24(5)18-11-14-22(2)3/h14-17,21H,8-13,18-20H2,1-7H3/b23-17+,24-15+,25-16+,26-21+ |
| InChIKey | WVIKYUIVFMNADS-VUGWYDRFSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|