C33H58 — CID 160792784
(3E,7E,11E)-3,7,11-trimethyltetradeca-3,7,11-triene;(6E,10E)-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 160792784) has the molecular formula C33H58 and a molecular weight of 454.83 g/mol. Its IUPAC name is (3E,7E,11E)-3,7,11-trimethyltetradeca-3,7,11-triene;(6E,10E)-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (3E,7E,11E)-3,7,11-trimethyltetradeca-3,7,11-triene;(6E,10E)-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 160792784 |
| Molecular Formula | C33H58 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.45 |
| IUPAC Name | (3E,7E,11E)-3,7,11-trimethyltetradeca-3,7,11-triene;(6E,10E)-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC.CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H30.C16H28/c1-6-10-16(4)12-9-14-17(5)13-8-11-15(3)7-2;1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h10-11,14H,6-9,12-13H2,1-5H3;9-10,13H,6-8,11-12H2,1-5H3/b15-11+,16-10+,17-14+;15-9+,16-13+ |
| InChIKey | SCARRSWCMMFYDZ-BEBONWBQSA-N |
| XLogP | 12.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|