C12H22O — CID 22749874
(3E,7E)-4,8-dimethyldeca-3,7-dien-1-ol (PubChem CID 22749874) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (3E,7E)-4,8-dimethyldeca-3,7-dien-1-ol.
| Compound Name | (3E,7E)-4,8-dimethyldeca-3,7-dien-1-ol |
|---|---|
| PubChem CID | 22749874 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (3E,7E)-4,8-dimethyldeca-3,7-dien-1-ol |
| SMILES | CC/C(C)=C/CC/C(C)=C/CCO |
| InChI | InChI=1S/C12H22O/c1-4-11(2)7-5-8-12(3)9-6-10-13/h7,9,13H,4-6,8,10H2,1-3H3/b11-7+,12-9+ |
| InChIKey | PZJYOYWEUMBZJB-HNWKWBPYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|