C14H22 — CID 159745410
(5E,9E)-6,10-dimethyldodeca-5,9-dien-1-yne (PubChem CID 159745410) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (5E,9E)-6,10-dimethyldodeca-5,9-dien-1-yne.
| Compound Name | (5E,9E)-6,10-dimethyldodeca-5,9-dien-1-yne |
|---|---|
| PubChem CID | 159745410 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (5E,9E)-6,10-dimethyldodeca-5,9-dien-1-yne |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CC |
| InChI | InChI=1S/C14H22/c1-5-7-8-10-14(4)12-9-11-13(3)6-2/h1,10-11H,6-9,12H2,2-4H3/b13-11+,14-10+ |
| InChIKey | NCZFFTUZKOTCLW-CKNIOMRDSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|