C19H27ClO3 — CID 122380460
ethyl (6E,10E)-2-chloro-6,10-dimethyl-3-oxopentadeca-6,10-dien-14-ynoate (PubChem CID 122380460) has the molecular formula C19H27ClO3 and a molecular weight of 338.88 g/mol. Its IUPAC name is ethyl (6E,10E)-2-chloro-6,10-dimethyl-3-oxopentadeca-6,10-dien-14-ynoate.
| Compound Name | ethyl (6E,10E)-2-chloro-6,10-dimethyl-3-oxopentadeca-6,10-dien-14-ynoate |
|---|---|
| PubChem CID | 122380460 |
| Molecular Formula | C19H27ClO3 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl (6E,10E)-2-chloro-6,10-dimethyl-3-oxopentadeca-6,10-dien-14-ynoate |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CCC(=O)C(Cl)C(=O)OCC |
| InChI | InChI=1S/C19H27ClO3/c1-5-7-8-10-15(3)11-9-12-16(4)13-14-17(21)18(20)19(22)23-6-2/h1,10,12,18H,6-9,11,13-14H2,2-4H3/b15-10+,16-12+ |
| InChIKey | JIHHBWNKBIBGFO-NCZFFCEISA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|