C17H30O3 — CID 13291922
(5Z)-1,1-diethoxy-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 13291922) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (5Z)-1,1-diethoxy-6,10-dimethylundeca-5,9-dien-2-one.
| Compound Name | (5Z)-1,1-diethoxy-6,10-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 13291922 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (5Z)-1,1-diethoxy-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | CCOC(OCC)C(=O)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C17H30O3/c1-6-19-17(20-7-2)16(18)13-9-12-15(5)11-8-10-14(3)4/h10,12,17H,6-9,11,13H2,1-5H3/b15-12- |
| InChIKey | HMLHVFICDTUCIV-QINSGFPZSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|