C22H38O5 — CID 19844979
(5Z,9E)-6-(dimethoxymethyl)-1,1-dimethoxy-10,14-dimethylpentadeca-5,9,13-trien-2-one (PubChem CID 19844979) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (5Z,9E)-6-(dimethoxymethyl)-1,1-dimethoxy-10,14-dimethylpentadeca-5,9,13-trien-2-one.
| Compound Name | (5Z,9E)-6-(dimethoxymethyl)-1,1-dimethoxy-10,14-dimethylpentadeca-5,9,13-trien-2-one |
|---|---|
| PubChem CID | 19844979 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (5Z,9E)-6-(dimethoxymethyl)-1,1-dimethoxy-10,14-dimethylpentadeca-5,9,13-trien-2-one |
| SMILES | COC(OC)C(=O)CC/C=C(/CC/C=C(\C)CCC=C(C)C)C(OC)OC |
| InChI | InChI=1S/C22H38O5/c1-17(2)11-8-12-18(3)13-9-14-19(21(24-4)25-5)15-10-16-20(23)22(26-6)27-7/h11,13,15,21-22H,8-10,12,14,16H2,1-7H3/b18-13+,19-15- |
| InChIKey | HAJNRLIRKSKXOO-BUFWFCRBSA-N |
| XLogP | 4.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|