C16H28O2 — CID 54386558
2-(dimethoxymethyl)-6,10-dimethylundeca-1,5,9-triene (PubChem CID 54386558) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-6,10-dimethylundeca-1,5,9-triene.
| Compound Name | 2-(dimethoxymethyl)-6,10-dimethylundeca-1,5,9-triene |
|---|---|
| PubChem CID | 54386558 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-(dimethoxymethyl)-6,10-dimethylundeca-1,5,9-triene |
| SMILES | C=C(CCC=C(C)CCC=C(C)C)C(OC)OC |
| InChI | InChI=1S/C16H28O2/c1-13(2)9-7-10-14(3)11-8-12-15(4)16(17-5)18-6/h9,11,16H,4,7-8,10,12H2,1-3,5-6H3 |
| InChIKey | VDQHMLAROWVUAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|