C20H34O3 — CID 23466447
(5E,9E)-1,1-dimethoxy-6,10,14-trimethylpentadeca-5,9,13-trien-2-one (PubChem CID 23466447) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (5E,9E)-1,1-dimethoxy-6,10,14-trimethylpentadeca-5,9,13-trien-2-one.
| Compound Name | (5E,9E)-1,1-dimethoxy-6,10,14-trimethylpentadeca-5,9,13-trien-2-one |
|---|---|
| PubChem CID | 23466447 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (5E,9E)-1,1-dimethoxy-6,10,14-trimethylpentadeca-5,9,13-trien-2-one |
| SMILES | COC(OC)C(=O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O3/c1-16(2)10-7-11-17(3)12-8-13-18(4)14-9-15-19(21)20(22-5)23-6/h10,12,14,20H,7-9,11,13,15H2,1-6H3/b17-12+,18-14+ |
| InChIKey | JBDHCSGTNQPBLE-NXGXIAAHSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|